|
|
|
Leap Chem Co., Ltdis a supplier of
|
 |
Chlorobutanol |
|
|
This listing includes other chemicals and chemical products supplied by Leap Chem Co., Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Leap Chem Co., Ltd |
LEAPChem, a specialized fine chemicals supplier for research, development and production.
LEAPChem provides nearly 5,000 rare and innovative chemical products to support the evolving needs of our customers in research & bulk manufacturing activities.
As a highly customer-oriented enterprise, we are committed to providing high-quality customer services and products to our global customers in a cost-effective and efficient manner.
Our client list includes many major pharmaceutical and science companies, universities, research institutions and chemical catalogue companies.
Methodology: Sound and Stable;Active and Innovative.
Attitude: Conscientious; Ingenious.
Goals: Customer’s Satisfaction
We regard client’s success as our success.
At LEAPChem we strive to be the preferred supplier for efficiency increasing and cost lowering in your Research&Production.
To achieve this strategic vision, we always push ourself to exceed our customer's requirement. By focusing 'Beyond Your Expectation' we continually expand our product line, enhance our systematic management and human resources.
Welcome to contact us and we look forward to becoming your preferred partner.
|
|
Leap Chem Co., Ltd also offers: Chlorobutane Chlorobromouron Chlorobromotrifluoroethane Chlorobromofosfamide Chloroborane Chlorobis[2-(diphenylphosphino)ethanamine]ruthenium(II) tetrafluoroborate Chlorobis-(cyclooctene)rhodium(I) dimer Chlorobis(pentyloxy)titanium Chlorobis(pentachlorophenyl)methyl radical Chlorobis(p-menth-3-yloxy)(methyl)silane Chlorobis(methoxymethylamino)phosphine Chlorobis(indenyl)vanadium(III) Chlorobis(dicyclohexylphenylphosphino)(2-methylphenyl)nickel(II) Chlorobis(dicyclohexylphenylphosphine)gold(I) Chlorobis(chloromethyl)arsine Chlorobis(4-chlorophenyl)phosphine Chlorobis(2-phenylpyridine)rhodium(III) dimer Chlorobis(2-chloroethoxy)arsine Chlorobis(1,2,2-trimethylhydrazino)phosphine Chlorobiphenylol Chlorobiocic acid Chlorobimane Chlorobenzuron Chlorobenzothiazole Chlorobenzilate Chlorobenzene-ul-14C Chlorobenzene-d5 Chlorobenzene-4-d1 Chlorobenzene-3,5-d2 Chlorobenzene-3,4,5-d3 Chlorobenzene-13C6 Chlorobenzene Chloroazepoxide Chloroauric acid Chloroaniline Chloroanilic acid lanthanum salt Chloroaluminum-1,8,15,22-tetramethyl-tetrapyrido-porphyrazine Chloroaluminum tetrasulfophthalocyanine Chloroalkanes C18-28 Chloroalkanes C14-17 Chloroalkanes C10-13 Chloroalbofungin Chloroacrolein Chloroacetylphosphonate Chloroacetylferrocene Chloroacetylaminoacetonitrile Chloroacetyl-ure Chloroacetyl-N-hydroxyleucyl-alanyl-glycinamide Chloroacetyl-L-valine Chloroacetyl-L-tyrosine
|
|
|
| Chlorobutanol is offered by other companies |
Refine Chemical Co.,Ltd.
|
OPQ Chemical Co., Ltd
|
X´ian Taicheng Chem Co., Ltd
|
Sancai Industry Co.,Ltd.
|
Lori Industry Co., Ltd
|
Zehao Industry Co., Ltd.
|
Hangzhou Lingrui Chemical Co., Ltd.
|
Skyrun Industrial Co., Ltd.
|
Xiamen Equation Chemical Co.,Ltd
|
Dayang Chem (Hangzhou) Co.,Ltd.
|
|
|
|
|
|